C16H26N4S — CID 103967819
N-(4-imidazol-1-ylbutyl)-2-thia-4-azaspiro[5.5]undec-3-en-3-amine (PubChem CID 103967819) has the molecular formula C16H26N4S and a molecular weight of 306.48 g/mol. Its IUPAC name is N-(4-imidazol-1-ylbutyl)-2-thia-4-azaspiro[5.5]undec-3-en-3-amine.
| Compound Name | N-(4-imidazol-1-ylbutyl)-2-thia-4-azaspiro[5.5]undec-3-en-3-amine |
|---|---|
| PubChem CID | 103967819 |
| Molecular Formula | C16H26N4S |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | N-(4-imidazol-1-ylbutyl)-2-thia-4-azaspiro[5.5]undec-3-en-3-amine |
| SMILES | c1cn(CCCCNC2=NCC3(CCCCC3)CS2)cn1 |
| InChI | InChI=1S/C16H26N4S/c1-2-6-16(7-3-1)12-19-15(21-13-16)18-8-4-5-10-20-11-9-17-14-20/h9,11,14H,1-8,10,12-13H2,(H,18,19) |
| InChIKey | UEWPMNBGEFJYCA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|