About N-(2-imidazol-1-ylethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine
N-(2-imidazol-1-ylethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine (PubChem CID 61460799) has the molecular formula C9H14N4S
and a molecular weight of 210.31 g/mol. Its IUPAC name is N-(2-imidazol-1-ylethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine.
Molecular Properties
| Compound Name | N-(2-imidazol-1-ylethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine |
| PubChem CID | 61460799 |
| Molecular Formula | C9H14N4S |
| Molecular Weight | 210.31 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | N-(2-imidazol-1-ylethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine |
| SMILES | c1cn(CCNC2=NCCCS2)cn1 |
| InChI | InChI=1S/C9H14N4S/c1-2-11-9(14-7-1)12-4-6-13-5-3-10-8-13/h3,5,8H,1-2,4,6-7H2,(H,11,12) |
| InChIKey | OVNIYYBISGGRGX-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.31 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2-imidazol-1-ylethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-imidazol-1-ylethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine?
The IUPAC name of N-(2-imidazol-1-ylethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine (CID 61460799) is N-(2-imidazol-1-ylethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine.
What is the SMILES notation for N-(2-imidazol-1-ylethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine?
The canonical SMILES for N-(2-imidazol-1-ylethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine is c1cn(CCNC2=NCCCS2)cn1.
What is the InChIKey of N-(2-imidazol-1-ylethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine?
The InChIKey is OVNIYYBISGGRGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4S/c1-2-11-9(14-7-1)12-4-6-13-5-3-10-8-13/h3,5,8H,1-2,4,6-7H2,(H,11,12).
What are the key properties of N-(2-imidazol-1-ylethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine?
N-(2-imidazol-1-ylethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine has a molecular weight of 210.31 g/mol, XLogP of 0.97, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-imidazol-1-ylethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine is sourced from PubChem (CID 61460799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).