About 7,8-dihydro-6H-pyrrolo[1,2-a][1,3,5]triazine-2,4-dione
7,8-dihydro-6H-pyrrolo[1,2-a][1,3,5]triazine-2,4-dione (PubChem CID 10397016) has the molecular formula C6H7N3O2
and a molecular weight of 153.14 g/mol. Its IUPAC name is 7,8-dihydro-6H-pyrrolo[1,2-a][1,3,5]triazine-2,4-dione.
Analyze 7,8-dihydro-6H-pyrrolo[1,2-a][1,3,5]triazine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dihydro-6H-pyrrolo[1,2-a][1,3,5]triazine-2,4-dione?
The IUPAC name of 7,8-dihydro-6H-pyrrolo[1,2-a][1,3,5]triazine-2,4-dione (CID 10397016) is 7,8-dihydro-6H-pyrrolo[1,2-a][1,3,5]triazine-2,4-dione.
What is the SMILES notation for 7,8-dihydro-6H-pyrrolo[1,2-a][1,3,5]triazine-2,4-dione?
The canonical SMILES for 7,8-dihydro-6H-pyrrolo[1,2-a][1,3,5]triazine-2,4-dione is O=c1nc2n(c(=O)[nH]1)CCC2.
What is the InChIKey of 7,8-dihydro-6H-pyrrolo[1,2-a][1,3,5]triazine-2,4-dione?
The InChIKey is GZPKTTTZWAHRJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O2/c10-5-7-4-2-1-3-9(4)6(11)8-5/h1-3H2,(H,8,10,11).
What are the key properties of 7,8-dihydro-6H-pyrrolo[1,2-a][1,3,5]triazine-2,4-dione?
7,8-dihydro-6H-pyrrolo[1,2-a][1,3,5]triazine-2,4-dione has a molecular weight of 153.14 g/mol, XLogP of -1.12, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dihydro-6H-pyrrolo[1,2-a][1,3,5]triazine-2,4-dione is sourced from PubChem (CID 10397016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).