C15H17N3 — CID 103980336
N-pyridin-3-yl-2,3,4,5-tetrahydro-1H-2-benzazepin-5-amine (PubChem CID 103980336) has the molecular formula C15H17N3 and a molecular weight of 239.32 g/mol. Its IUPAC name is N-pyridin-3-yl-2,3,4,5-tetrahydro-1H-2-benzazepin-5-amine.
| Compound Name | N-pyridin-3-yl-2,3,4,5-tetrahydro-1H-2-benzazepin-5-amine |
|---|---|
| PubChem CID | 103980336 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | N-pyridin-3-yl-2,3,4,5-tetrahydro-1H-2-benzazepin-5-amine |
| SMILES | c1cncc(NC2CCNCc3ccccc32)c1 |
| InChI | InChI=1S/C15H17N3/c1-2-6-14-12(4-1)10-17-9-7-15(14)18-13-5-3-8-16-11-13/h1-6,8,11,15,17-18H,7,9-10H2 |
| InChIKey | NXESBVNJARVIKP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |