C17H18N4 — CID 103981456
N-(1H-indazol-6-yl)-2,3,4,5-tetrahydro-1H-2-benzazepin-5-amine (PubChem CID 103981456) has the molecular formula C17H18N4 and a molecular weight of 278.36 g/mol. Its IUPAC name is N-(1H-indazol-6-yl)-2,3,4,5-tetrahydro-1H-2-benzazepin-5-amine.
| Compound Name | N-(1H-indazol-6-yl)-2,3,4,5-tetrahydro-1H-2-benzazepin-5-amine |
|---|---|
| PubChem CID | 103981456 |
| Molecular Formula | C17H18N4 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | N-(1H-indazol-6-yl)-2,3,4,5-tetrahydro-1H-2-benzazepin-5-amine |
| SMILES | c1ccc2c(c1)CNCCC2Nc1ccc2cn[nH]c2c1 |
| InChI | InChI=1S/C17H18N4/c1-2-4-15-12(3-1)10-18-8-7-16(15)20-14-6-5-13-11-19-21-17(13)9-14/h1-6,9,11,16,18,20H,7-8,10H2,(H,19,21) |
| InChIKey | ICANKTBHXPBNEE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |