C14H16N2S — CID 103982407
N-thiophen-3-yl-2,3,4,5-tetrahydro-1H-2-benzazepin-5-amine (PubChem CID 103982407) has the molecular formula C14H16N2S and a molecular weight of 244.36 g/mol. Its IUPAC name is N-thiophen-3-yl-2,3,4,5-tetrahydro-1H-2-benzazepin-5-amine.
| Compound Name | N-thiophen-3-yl-2,3,4,5-tetrahydro-1H-2-benzazepin-5-amine |
|---|---|
| PubChem CID | 103982407 |
| Molecular Formula | C14H16N2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | N-thiophen-3-yl-2,3,4,5-tetrahydro-1H-2-benzazepin-5-amine |
| SMILES | c1ccc2c(c1)CNCCC2Nc1ccsc1 |
| InChI | InChI=1S/C14H16N2S/c1-2-4-13-11(3-1)9-15-7-5-14(13)16-12-6-8-17-10-12/h1-4,6,8,10,14-16H,5,7,9H2 |
| InChIKey | UGIOSQUNPVLPDT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |