C19H32O7 — CID 10406957
methyl (2E,6S)-2,6-dimethyl-6-[(2S,3R,4S,5R)-3,4,5-trimethoxyoxan-2-yl]oxyocta-2,7-dienoate (PubChem CID 10406957) has the molecular formula C19H32O7 and a molecular weight of 372.46 g/mol. Its IUPAC name is methyl (2E,6S)-2,6-dimethyl-6-[(2S,3R,4S,5R)-3,4,5-trimethoxyoxan-2-yl]oxyocta-2,7-dienoate.
| Compound Name | methyl (2E,6S)-2,6-dimethyl-6-[(2S,3R,4S,5R)-3,4,5-trimethoxyoxan-2-yl]oxyocta-2,7-dienoate |
|---|---|
| PubChem CID | 10406957 |
| Molecular Formula | C19H32O7 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | methyl (2E,6S)-2,6-dimethyl-6-[(2S,3R,4S,5R)-3,4,5-trimethoxyoxan-2-yl]oxyocta-2,7-dienoate |
| SMILES | C=C[C@](C)(CC/C=C(\C)C(=O)OC)O[C@@H]1OC[C@@H](OC)[C@H](OC)[C@H]1OC |
| InChI | InChI=1S/C19H32O7/c1-8-19(3,11-9-10-13(2)17(20)24-7)26-18-16(23-6)15(22-5)14(21-4)12-25-18/h8,10,14-16,18H,1,9,11-12H2,2-7H3/b13-10+/t14-,15+,16-,18+,19-/m1/s1 |
| InChIKey | JNBBYYUBEHKZIP-OLBFLYGJSA-N |
| XLogP | 2.25 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|