C22H22ClN5O — CID 10409144
(E)-3-[(6aR,9S,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-N-(6-chloropyridazin-3-yl)prop-2-enamide (PubChem CID 10409144) has the molecular formula C22H22ClN5O and a molecular weight of 407.91 g/mol. Its IUPAC name is (E)-3-[(6aR,9S,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-N-(6-chloropyridazin-3-yl)prop-2-enamide.
| Compound Name | (E)-3-[(6aR,9S,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-N-(6-chloropyridazin-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 10409144 |
| Molecular Formula | C22H22ClN5O |
| Molecular Weight | 407.91 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | (E)-3-[(6aR,9S,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-N-(6-chloropyridazin-3-yl)prop-2-enamide |
| SMILES | CN1C[C@H](/C=C/C(=O)Nc2ccc(Cl)nn2)C[C@@H]2c3cccc4[nH]cc(c34)C[C@H]21 |
| InChI | InChI=1S/C22H22ClN5O/c1-28-12-13(5-8-21(29)25-20-7-6-19(23)26-27-20)9-16-15-3-2-4-17-22(15)14(11-24-17)10-18(16)28/h2-8,11,13,16,18,24H,9-10,12H2,1H3,(H,25,27,29)/b8-5+/t13-,16-,18-/m1/s1 |
| InChIKey | BAGIQCFEHQXOGH-MDGJJVPTSA-N |
| XLogP | 3.77 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.91 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|