C21H20ClN5O — CID 54265064
2-[(6aR)-7-methyl-4,6,6a,8,10,10a-hexahydroindolo[4,3-fg]quinolin-9-ylidene]-N-(6-chloropyridazin-3-yl)acetamide (PubChem CID 54265064) has the molecular formula C21H20ClN5O and a molecular weight of 393.88 g/mol. Its IUPAC name is 2-[(6aR)-7-methyl-4,6,6a,8,10,10a-hexahydroindolo[4,3-fg]quinolin-9-ylidene]-N-(6-chloropyridazin-3-yl)acetamide.
| Compound Name | 2-[(6aR)-7-methyl-4,6,6a,8,10,10a-hexahydroindolo[4,3-fg]quinolin-9-ylidene]-N-(6-chloropyridazin-3-yl)acetamide |
|---|---|
| PubChem CID | 54265064 |
| Molecular Formula | C21H20ClN5O |
| Molecular Weight | 393.88 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 2-[(6aR)-7-methyl-4,6,6a,8,10,10a-hexahydroindolo[4,3-fg]quinolin-9-ylidene]-N-(6-chloropyridazin-3-yl)acetamide |
| SMILES | CN1CC(=CC(=O)Nc2ccc(Cl)nn2)CC2c3cccc4[nH]cc(c34)C[C@H]21 |
| InChI | InChI=1S/C21H20ClN5O/c1-27-11-12(8-20(28)24-19-6-5-18(22)25-26-19)7-15-14-3-2-4-16-21(14)13(10-23-16)9-17(15)27/h2-6,8,10,15,17,23H,7,9,11H2,1H3,(H,24,26,28)/t15?,17-/m1/s1 |
| InChIKey | RGENCXCKPLBMQF-OMOCHNIRSA-N |
| XLogP | 3.52 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.88 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|