C24H24ClN5O — CID 10765259
(E)-3-[(6aR,9S,10aR)-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-N-(6-chloropyridazin-3-yl)prop-2-enamide (PubChem CID 10765259) has the molecular formula C24H24ClN5O and a molecular weight of 433.94 g/mol. Its IUPAC name is (E)-3-[(6aR,9S,10aR)-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-N-(6-chloropyridazin-3-yl)prop-2-enamide.
| Compound Name | (E)-3-[(6aR,9S,10aR)-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-N-(6-chloropyridazin-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 10765259 |
| Molecular Formula | C24H24ClN5O |
| Molecular Weight | 433.94 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | (E)-3-[(6aR,9S,10aR)-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-N-(6-chloropyridazin-3-yl)prop-2-enamide |
| SMILES | C=CCN1C[C@H](/C=C/C(=O)Nc2ccc(Cl)nn2)C[C@@H]2c3cccc4[nH]cc(c34)C[C@H]21 |
| InChI | InChI=1S/C24H24ClN5O/c1-2-10-30-14-15(6-9-23(31)27-22-8-7-21(25)28-29-22)11-18-17-4-3-5-19-24(17)16(13-26-19)12-20(18)30/h2-9,13,15,18,20,26H,1,10-12,14H2,(H,27,29,31)/b9-6+/t15-,18-,20-/m1/s1 |
| InChIKey | KBSCWOBKMNRCDZ-KVQVPNHPSA-N |
| XLogP | 4.32 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.94 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|