C21H29N3O6 — CID 10409828
methyl (2S)-2-[[(2S)-1-(2-acetyloxy-5-aminobenzoyl)pyrrolidine-2-carbonyl]amino]-4-methylpentanoate (PubChem CID 10409828) has the molecular formula C21H29N3O6 and a molecular weight of 419.48 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-1-(2-acetyloxy-5-aminobenzoyl)pyrrolidine-2-carbonyl]amino]-4-methylpentanoate.
| Compound Name | methyl (2S)-2-[[(2S)-1-(2-acetyloxy-5-aminobenzoyl)pyrrolidine-2-carbonyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 10409828 |
| Molecular Formula | C21H29N3O6 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | methyl (2S)-2-[[(2S)-1-(2-acetyloxy-5-aminobenzoyl)pyrrolidine-2-carbonyl]amino]-4-methylpentanoate |
| SMILES | COC(=O)[C@H](CC(C)C)NC(=O)[C@@H]1CCCN1C(=O)c1cc(N)ccc1OC(C)=O |
| InChI | InChI=1S/C21H29N3O6/c1-12(2)10-16(21(28)29-4)23-19(26)17-6-5-9-24(17)20(27)15-11-14(22)7-8-18(15)30-13(3)25/h7-8,11-12,16-17H,5-6,9-10,22H2,1-4H3,(H,23,26)/t16-,17-/m0/s1 |
| InChIKey | CXJZQCSBEXUPPW-IRXDYDNUSA-N |
| XLogP | 1.50 |
| TPSA | 128.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|