C23H24O8 — CID 10410309
3,7-dihydroxy-2-[3-(2-hydroxy-3-methylbut-3-enyl)-4-methoxyphenyl]-5,6-dimethoxychromen-4-one (PubChem CID 10410309) has the molecular formula C23H24O8 and a molecular weight of 428.44 g/mol. Its IUPAC name is 3,7-dihydroxy-2-[3-(2-hydroxy-3-methylbut-3-enyl)-4-methoxyphenyl]-5,6-dimethoxychromen-4-one.
| Compound Name | 3,7-dihydroxy-2-[3-(2-hydroxy-3-methylbut-3-enyl)-4-methoxyphenyl]-5,6-dimethoxychromen-4-one |
|---|---|
| PubChem CID | 10410309 |
| Molecular Formula | C23H24O8 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 3,7-dihydroxy-2-[3-(2-hydroxy-3-methylbut-3-enyl)-4-methoxyphenyl]-5,6-dimethoxychromen-4-one |
| SMILES | C=C(C)C(O)Cc1cc(-c2oc3cc(O)c(OC)c(OC)c3c(=O)c2O)ccc1OC |
| InChI | InChI=1S/C23H24O8/c1-11(2)14(24)9-13-8-12(6-7-16(13)28-3)21-20(27)19(26)18-17(31-21)10-15(25)22(29-4)23(18)30-5/h6-8,10,14,24-25,27H,1,9H2,2-5H3 |
| InChIKey | VSIPYJYMDXQPCZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 118.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|