C28H45N3O4S — CID 10414304
tert-butyl N-[2-[[(3S,4aS,8aS)-3-(tert-butylcarbamoyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]sulfinyl]-3-phenylpropyl]carbamate (PubChem CID 10414304) has the molecular formula C28H45N3O4S and a molecular weight of 519.75 g/mol. Its IUPAC name is tert-butyl N-[2-[[(3S,4aS,8aS)-3-(tert-butylcarbamoyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]sulfinyl]-3-phenylpropyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(3S,4aS,8aS)-3-(tert-butylcarbamoyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]sulfinyl]-3-phenylpropyl]carbamate |
|---|---|
| PubChem CID | 10414304 |
| Molecular Formula | C28H45N3O4S |
| Molecular Weight | 519.75 g/mol |
| Exact Mass | 519.31 |
| IUPAC Name | tert-butyl N-[2-[[(3S,4aS,8aS)-3-(tert-butylcarbamoyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]sulfinyl]-3-phenylpropyl]carbamate |
| SMILES | CC(C)(C)NC(=O)[C@@H]1C[C@@H]2CCCC[C@@H]2CN1S(=O)C(CNC(=O)OC(C)(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C28H45N3O4S/c1-27(2,3)30-25(32)24-17-21-14-10-11-15-22(21)19-31(24)36(34)23(16-20-12-8-7-9-13-20)18-29-26(33)35-28(4,5)6/h7-9,12-13,21-24H,10-11,14-19H2,1-6H3,(H,29,33)(H,30,32)/t21-,22+,23?,24-,36?/m0/s1 |
| InChIKey | AYQHMEMGQRMCKG-SQVADLBRSA-N |
| XLogP | 4.58 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.75 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |