C30H48N6O3 — CID 142142338
(4aS)-N-tert-butyl-2-[3-[2-(2,3-dihydro-1H-imidazole-4-carbonylamino)ethylamino]-2-hydroxy-4-phenylbutyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide (PubChem CID 142142338) has the molecular formula C30H48N6O3 and a molecular weight of 540.75 g/mol. Its IUPAC name is (4aS)-N-tert-butyl-2-[3-[2-(2,3-dihydro-1H-imidazole-4-carbonylamino)ethylamino]-2-hydroxy-4-phenylbutyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide.
| Compound Name | (4aS)-N-tert-butyl-2-[3-[2-(2,3-dihydro-1H-imidazole-4-carbonylamino)ethylamino]-2-hydroxy-4-phenylbutyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 142142338 |
| Molecular Formula | C30H48N6O3 |
| Molecular Weight | 540.75 g/mol |
| Exact Mass | 540.38 |
| IUPAC Name | (4aS)-N-tert-butyl-2-[3-[2-(2,3-dihydro-1H-imidazole-4-carbonylamino)ethylamino]-2-hydroxy-4-phenylbutyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide |
| SMILES | CC(C)(C)NC(=O)C1C[C@@H]2CCCCC2CN1CC(O)C(Cc1ccccc1)NCCNC(=O)C1=CNCN1 |
| InChI | InChI=1S/C30H48N6O3/c1-30(2,3)35-29(39)26-16-22-11-7-8-12-23(22)18-36(26)19-27(37)24(15-21-9-5-4-6-10-21)32-13-14-33-28(38)25-17-31-20-34-25/h4-6,9-10,17,22-24,26-27,31-32,34,37H,7-8,11-16,18-20H2,1-3H3,(H,33,38)(H,35,39)/t22-,23?,24?,26?,27?/m0/s1 |
| InChIKey | LKSUBBXVZNVYFX-IIOUSHKASA-N |
| XLogP | 1.45 |
| TPSA | 117.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.75 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|