C13H19HgO2 — CID 10414348
[(1Z)-1-(3-butyl-2-methoxy-2-methyl-5-oxocyclopent-3-en-1-ylidene)ethyl]mercury (PubChem CID 10414348) has the molecular formula C13H19HgO2 and a molecular weight of 407.88 g/mol. Its IUPAC name is [(1Z)-1-(3-butyl-2-methoxy-2-methyl-5-oxocyclopent-3-en-1-ylidene)ethyl]mercury.
| Compound Name | [(1Z)-1-(3-butyl-2-methoxy-2-methyl-5-oxocyclopent-3-en-1-ylidene)ethyl]mercury |
|---|---|
| PubChem CID | 10414348 |
| Molecular Formula | C13H19HgO2 |
| Molecular Weight | 407.88 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | [(1Z)-1-(3-butyl-2-methoxy-2-methyl-5-oxocyclopent-3-en-1-ylidene)ethyl]mercury |
| SMILES | CCCCC1=CC(=O)/C(=C(/C)[Hg])C1(C)OC |
| InChI | InChI=1S/C13H19O2.Hg/c1-5-7-8-10-9-12(14)11(6-2)13(10,3)15-4;/h9H,5,7-8H2,1-4H3; |
| InChIKey | FGTCCMLGBJQRIG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.88 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|