C8H9NO4S — CID 10420824
2-(2,2-dioxo-1,3,2λ6-benzodioxathiol-5-yl)ethanamine (PubChem CID 10420824) has the molecular formula C8H9NO4S and a molecular weight of 215.23 g/mol. Its IUPAC name is 2-(2,2-dioxo-1,3,2λ6-benzodioxathiol-5-yl)ethanamine.
| Compound Name | 2-(2,2-dioxo-1,3,2λ6-benzodioxathiol-5-yl)ethanamine |
|---|---|
| PubChem CID | 10420824 |
| Molecular Formula | C8H9NO4S |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | 2-(2,2-dioxo-1,3,2λ6-benzodioxathiol-5-yl)ethanamine |
| SMILES | NCCc1ccc2c(c1)OS(=O)(=O)O2 |
| InChI | InChI=1S/C8H9NO4S/c9-4-3-6-1-2-7-8(5-6)13-14(10,11)12-7/h1-2,5H,3-4,9H2 |
| InChIKey | OEKFOZAUEVTOAW-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |