C16H23NO2 — CID 10422777
5-[(1S)-1-phenylbutoxy]-3-propyl-4,5-dihydro-1,2-oxazole (PubChem CID 10422777) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is 5-[(1S)-1-phenylbutoxy]-3-propyl-4,5-dihydro-1,2-oxazole.
| Compound Name | 5-[(1S)-1-phenylbutoxy]-3-propyl-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 10422777 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 5-[(1S)-1-phenylbutoxy]-3-propyl-4,5-dihydro-1,2-oxazole |
| SMILES | CCCC1=NOC(O[C@@H](CCC)c2ccccc2)C1 |
| InChI | InChI=1S/C16H23NO2/c1-3-8-14-12-16(19-17-14)18-15(9-4-2)13-10-6-5-7-11-13/h5-7,10-11,15-16H,3-4,8-9,12H2,1-2H3/t15-,16?/m0/s1 |
| InChIKey | JIHADNHAJABZFY-VYRBHSGPSA-N |
| XLogP | 4.45 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |