C20H28O2 — CID 10424897
(Z)-2,2,8,8-tetramethyl-5-(4-methylphenyl)non-4-ene-3,7-dione (PubChem CID 10424897) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is (Z)-2,2,8,8-tetramethyl-5-(4-methylphenyl)non-4-ene-3,7-dione.
| Compound Name | (Z)-2,2,8,8-tetramethyl-5-(4-methylphenyl)non-4-ene-3,7-dione |
|---|---|
| PubChem CID | 10424897 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (Z)-2,2,8,8-tetramethyl-5-(4-methylphenyl)non-4-ene-3,7-dione |
| SMILES | Cc1ccc(/C(=C\C(=O)C(C)(C)C)CC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H28O2/c1-14-8-10-15(11-9-14)16(12-17(21)19(2,3)4)13-18(22)20(5,6)7/h8-12H,13H2,1-7H3/b16-12- |
| InChIKey | CRHDCZNYXAUFDB-VBKFSLOCSA-N |
| XLogP | 5.00 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|