C15H17F3O3S — CID 139648721
(Z)-6,6,6-trifluoro-2,2-dimethyl-5-(4-methylphenyl)sulfonylhex-4-en-3-one (PubChem CID 139648721) has the molecular formula C15H17F3O3S and a molecular weight of 334.36 g/mol. Its IUPAC name is (Z)-6,6,6-trifluoro-2,2-dimethyl-5-(4-methylphenyl)sulfonylhex-4-en-3-one.
| Compound Name | (Z)-6,6,6-trifluoro-2,2-dimethyl-5-(4-methylphenyl)sulfonylhex-4-en-3-one |
|---|---|
| PubChem CID | 139648721 |
| Molecular Formula | C15H17F3O3S |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | (Z)-6,6,6-trifluoro-2,2-dimethyl-5-(4-methylphenyl)sulfonylhex-4-en-3-one |
| SMILES | Cc1ccc(S(=O)(=O)/C(=C\C(=O)C(C)(C)C)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H17F3O3S/c1-10-5-7-11(8-6-10)22(20,21)13(15(16,17)18)9-12(19)14(2,3)4/h5-9H,1-4H3/b13-9- |
| InChIKey | PDIWYFXLTZZDOT-LCYFTJDESA-N |
| XLogP | 3.83 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|