About [(E)-2-methyl-3-(4-methylphenyl)but-2-enyl] 2,2-dimethylpropanoate
[(E)-2-methyl-3-(4-methylphenyl)but-2-enyl] 2,2-dimethylpropanoate (PubChem CID 153370087) has the molecular formula C17H24O2
and a molecular weight of 260.38 g/mol. Its IUPAC name is [(E)-2-methyl-3-(4-methylphenyl)but-2-enyl] 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [(E)-2-methyl-3-(4-methylphenyl)but-2-enyl] 2,2-dimethylpropanoate |
| PubChem CID | 153370087 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | [(E)-2-methyl-3-(4-methylphenyl)but-2-enyl] 2,2-dimethylpropanoate |
| SMILES | C/C(COC(=O)C(C)(C)C)=C(/C)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H24O2/c1-12-7-9-15(10-8-12)14(3)13(2)11-19-16(18)17(4,5)6/h7-10H,11H2,1-6H3/b14-13+ |
| InChIKey | XQEJBAYABQWNEE-BUHFOSPRSA-N |
| XLogP | 4.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(E)-2-methyl-3-(4-methylphenyl)but-2-enyl] 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-2-methyl-3-(4-methylphenyl)but-2-enyl] 2,2-dimethylpropanoate?
The IUPAC name of [(E)-2-methyl-3-(4-methylphenyl)but-2-enyl] 2,2-dimethylpropanoate (CID 153370087) is [(E)-2-methyl-3-(4-methylphenyl)but-2-enyl] 2,2-dimethylpropanoate.
What is the SMILES notation for [(E)-2-methyl-3-(4-methylphenyl)but-2-enyl] 2,2-dimethylpropanoate?
The canonical SMILES for [(E)-2-methyl-3-(4-methylphenyl)but-2-enyl] 2,2-dimethylpropanoate is C/C(COC(=O)C(C)(C)C)=C(/C)c1ccc(C)cc1.
What is the InChIKey of [(E)-2-methyl-3-(4-methylphenyl)but-2-enyl] 2,2-dimethylpropanoate?
The InChIKey is XQEJBAYABQWNEE-BUHFOSPRSA-N. The full InChI is InChI=1S/C17H24O2/c1-12-7-9-15(10-8-12)14(3)13(2)11-19-16(18)17(4,5)6/h7-10H,11H2,1-6H3/b14-13+.
What are the key properties of [(E)-2-methyl-3-(4-methylphenyl)but-2-enyl] 2,2-dimethylpropanoate?
[(E)-2-methyl-3-(4-methylphenyl)but-2-enyl] 2,2-dimethylpropanoate has a molecular weight of 260.38 g/mol, XLogP of 4.38, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-2-methyl-3-(4-methylphenyl)but-2-enyl] 2,2-dimethylpropanoate is sourced from PubChem (CID 153370087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).