About ethene;1-methyl-4-[(Z)-3-methylpent-2-en-2-yl]benzene
ethene;1-methyl-4-[(Z)-3-methylpent-2-en-2-yl]benzene (PubChem CID 142494445) has the molecular formula C15H22
and a molecular weight of 202.34 g/mol. Its IUPAC name is ethene;1-methyl-4-[(Z)-3-methylpent-2-en-2-yl]benzene.
Molecular Properties
| Compound Name | ethene;1-methyl-4-[(Z)-3-methylpent-2-en-2-yl]benzene |
| PubChem CID | 142494445 |
| Molecular Formula | C15H22 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | ethene;1-methyl-4-[(Z)-3-methylpent-2-en-2-yl]benzene |
| SMILES | C=C.CC/C(C)=C(/C)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H18.C2H4/c1-5-11(3)12(4)13-8-6-10(2)7-9-13;1-2/h6-9H,5H2,1-4H3;1-2H2/b12-11-; |
| InChIKey | PQLUGZUTBUOMHG-AFEZEDKISA-N |
| XLogP | 5.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;1-methyl-4-[(Z)-3-methylpent-2-en-2-yl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;1-methyl-4-[(Z)-3-methylpent-2-en-2-yl]benzene?
The IUPAC name of ethene;1-methyl-4-[(Z)-3-methylpent-2-en-2-yl]benzene (CID 142494445) is ethene;1-methyl-4-[(Z)-3-methylpent-2-en-2-yl]benzene.
What is the SMILES notation for ethene;1-methyl-4-[(Z)-3-methylpent-2-en-2-yl]benzene?
The canonical SMILES for ethene;1-methyl-4-[(Z)-3-methylpent-2-en-2-yl]benzene is C=C.CC/C(C)=C(/C)c1ccc(C)cc1.
What is the InChIKey of ethene;1-methyl-4-[(Z)-3-methylpent-2-en-2-yl]benzene?
The InChIKey is PQLUGZUTBUOMHG-AFEZEDKISA-N. The full InChI is InChI=1S/C13H18.C2H4/c1-5-11(3)12(4)13-8-6-10(2)7-9-13;1-2/h6-9H,5H2,1-4H3;1-2H2/b12-11-;.
What are the key properties of ethene;1-methyl-4-[(Z)-3-methylpent-2-en-2-yl]benzene?
ethene;1-methyl-4-[(Z)-3-methylpent-2-en-2-yl]benzene has a molecular weight of 202.34 g/mol, XLogP of 5.00, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;1-methyl-4-[(Z)-3-methylpent-2-en-2-yl]benzene is sourced from PubChem (CID 142494445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).