C21H18BrN3O3S — CID 1042549
N-[[4-(3-bromophenyl)-3-prop-2-enyl-1,3-thiazol-2-ylidene]amino]-2,3-dihydro-1,4-benzodioxine-6-carboxamide (PubChem CID 1042549) has the molecular formula C21H18BrN3O3S and a molecular weight of 472.36 g/mol. Its IUPAC name is N-[[4-(3-bromophenyl)-3-prop-2-enyl-1,3-thiazol-2-ylidene]amino]-2,3-dihydro-1,4-benzodioxine-6-carboxamide.
| Compound Name | N-[[4-(3-bromophenyl)-3-prop-2-enyl-1,3-thiazol-2-ylidene]amino]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
|---|---|
| PubChem CID | 1042549 |
| Molecular Formula | C21H18BrN3O3S |
| Molecular Weight | 472.36 g/mol |
| Exact Mass | 471.03 |
| IUPAC Name | N-[[4-(3-bromophenyl)-3-prop-2-enyl-1,3-thiazol-2-ylidene]amino]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| SMILES | C=CCn1c(-c2cccc(Br)c2)csc1=NNC(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C21H18BrN3O3S/c1-2-8-25-17(14-4-3-5-16(22)11-14)13-29-21(25)24-23-20(26)15-6-7-18-19(12-15)28-10-9-27-18/h2-7,11-13H,1,8-10H2,(H,23,26) |
| InChIKey | ZLTSVRKODURSER-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.36 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|