C16H17ClN4O3 — CID 10427866
13-chloro-5,7-dipropyl-1,5,7,9-tetrazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraene-2,4,6-trione (PubChem CID 10427866) has the molecular formula C16H17ClN4O3 and a molecular weight of 348.79 g/mol. Its IUPAC name is 13-chloro-5,7-dipropyl-1,5,7,9-tetrazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraene-2,4,6-trione.
| Compound Name | 13-chloro-5,7-dipropyl-1,5,7,9-tetrazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraene-2,4,6-trione |
|---|---|
| PubChem CID | 10427866 |
| Molecular Formula | C16H17ClN4O3 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 13-chloro-5,7-dipropyl-1,5,7,9-tetrazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraene-2,4,6-trione |
| SMILES | CCCn1c(=O)c2c(=O)n3cc(Cl)ccc3nc2n(CCC)c1=O |
| InChI | InChI=1S/C16H17ClN4O3/c1-3-7-19-13-12(14(22)20(8-4-2)16(19)24)15(23)21-9-10(17)5-6-11(21)18-13/h5-6,9H,3-4,7-8H2,1-2H3 |
| InChIKey | NQBBFDRBYCAFFC-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 78.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|