C17H16N6O2S — CID 10429108
methyl 2-[[5-cyano-2-methyl-4-(2-phenylhydrazinyl)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]sulfanyl]acetate (PubChem CID 10429108) has the molecular formula C17H16N6O2S and a molecular weight of 368.42 g/mol. Its IUPAC name is methyl 2-[[5-cyano-2-methyl-4-(2-phenylhydrazinyl)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]sulfanyl]acetate.
| Compound Name | methyl 2-[[5-cyano-2-methyl-4-(2-phenylhydrazinyl)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 10429108 |
| Molecular Formula | C17H16N6O2S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | methyl 2-[[5-cyano-2-methyl-4-(2-phenylhydrazinyl)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]sulfanyl]acetate |
| SMILES | COC(=O)CSc1[nH]c2nc(C)nc(NNc3ccccc3)c2c1C#N |
| InChI | InChI=1S/C17H16N6O2S/c1-10-19-15-14(12(8-18)17(21-15)26-9-13(24)25-2)16(20-10)23-22-11-6-4-3-5-7-11/h3-7,22H,9H2,1-2H3,(H2,19,20,21,23) |
| InChIKey | WOIHKZPETRUQAC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 115.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|