C20H15N3O2S — CID 10737300
methyl 2-(5-cyano-2,6-diphenylpyrimidin-4-yl)sulfanylacetate (PubChem CID 10737300) has the molecular formula C20H15N3O2S and a molecular weight of 361.43 g/mol. Its IUPAC name is methyl 2-(5-cyano-2,6-diphenylpyrimidin-4-yl)sulfanylacetate.
| Compound Name | methyl 2-(5-cyano-2,6-diphenylpyrimidin-4-yl)sulfanylacetate |
|---|---|
| PubChem CID | 10737300 |
| Molecular Formula | C20H15N3O2S |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | methyl 2-(5-cyano-2,6-diphenylpyrimidin-4-yl)sulfanylacetate |
| SMILES | COC(=O)CSc1nc(-c2ccccc2)nc(-c2ccccc2)c1C#N |
| InChI | InChI=1S/C20H15N3O2S/c1-25-17(24)13-26-20-16(12-21)18(14-8-4-2-5-9-14)22-19(23-20)15-10-6-3-7-11-15/h2-11H,13H2,1H3 |
| InChIKey | DZHPSBLJHRZGGM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 75.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |