C16H12N2O5S — CID 176980575
3-[3-cyano-2-(2-methoxy-2-oxoethyl)sulfanyl-6-oxo-1H-pyridin-4-yl]benzoic acid (PubChem CID 176980575) has the molecular formula C16H12N2O5S and a molecular weight of 344.35 g/mol. Its IUPAC name is 3-[3-cyano-2-(2-methoxy-2-oxoethyl)sulfanyl-6-oxo-1H-pyridin-4-yl]benzoic acid.
| Compound Name | 3-[3-cyano-2-(2-methoxy-2-oxoethyl)sulfanyl-6-oxo-1H-pyridin-4-yl]benzoic acid |
|---|---|
| PubChem CID | 176980575 |
| Molecular Formula | C16H12N2O5S |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | 3-[3-cyano-2-(2-methoxy-2-oxoethyl)sulfanyl-6-oxo-1H-pyridin-4-yl]benzoic acid |
| SMILES | COC(=O)CSc1[nH]c(=O)cc(-c2cccc(C(=O)O)c2)c1C#N |
| InChI | InChI=1S/C16H12N2O5S/c1-23-14(20)8-24-15-12(7-17)11(6-13(19)18-15)9-3-2-4-10(5-9)16(21)22/h2-6H,8H2,1H3,(H,18,19)(H,21,22) |
| InChIKey | LYUIJSKULLRDDO-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 120.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |