C18H20O5S2 — CID 10429878
2,4-bis(benzenesulfonyl)-2-methylpentan-3-one (PubChem CID 10429878) has the molecular formula C18H20O5S2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 2,4-bis(benzenesulfonyl)-2-methylpentan-3-one.
| Compound Name | 2,4-bis(benzenesulfonyl)-2-methylpentan-3-one |
|---|---|
| PubChem CID | 10429878 |
| Molecular Formula | C18H20O5S2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 2,4-bis(benzenesulfonyl)-2-methylpentan-3-one |
| SMILES | CC(C(=O)C(C)(C)S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H20O5S2/c1-14(24(20,21)15-10-6-4-7-11-15)17(19)18(2,3)25(22,23)16-12-8-5-9-13-16/h4-14H,1-3H3 |
| InChIKey | PCRTWEVYLVMDQI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |