About 1-hydroxyethyl 2-(benzenesulfonyl)-2-methylpropanoate
1-hydroxyethyl 2-(benzenesulfonyl)-2-methylpropanoate (PubChem CID 135330972) has the molecular formula C12H16O5S
and a molecular weight of 272.32 g/mol. Its IUPAC name is 1-hydroxyethyl 2-(benzenesulfonyl)-2-methylpropanoate.
Molecular Properties
| Compound Name | 1-hydroxyethyl 2-(benzenesulfonyl)-2-methylpropanoate |
| PubChem CID | 135330972 |
| Molecular Formula | C12H16O5S |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 1-hydroxyethyl 2-(benzenesulfonyl)-2-methylpropanoate |
| SMILES | CC(O)OC(=O)C(C)(C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H16O5S/c1-9(13)17-11(14)12(2,3)18(15,16)10-7-5-4-6-8-10/h4-9,13H,1-3H3 |
| InChIKey | NQUCQLIQNCQQIQ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxyethyl 2-(benzenesulfonyl)-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxyethyl 2-(benzenesulfonyl)-2-methylpropanoate?
The IUPAC name of 1-hydroxyethyl 2-(benzenesulfonyl)-2-methylpropanoate (CID 135330972) is 1-hydroxyethyl 2-(benzenesulfonyl)-2-methylpropanoate.
What is the SMILES notation for 1-hydroxyethyl 2-(benzenesulfonyl)-2-methylpropanoate?
The canonical SMILES for 1-hydroxyethyl 2-(benzenesulfonyl)-2-methylpropanoate is CC(O)OC(=O)C(C)(C)S(=O)(=O)c1ccccc1.
What is the InChIKey of 1-hydroxyethyl 2-(benzenesulfonyl)-2-methylpropanoate?
The InChIKey is NQUCQLIQNCQQIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O5S/c1-9(13)17-11(14)12(2,3)18(15,16)10-7-5-4-6-8-10/h4-9,13H,1-3H3.
What are the key properties of 1-hydroxyethyl 2-(benzenesulfonyl)-2-methylpropanoate?
1-hydroxyethyl 2-(benzenesulfonyl)-2-methylpropanoate has a molecular weight of 272.32 g/mol, XLogP of 1.12, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxyethyl 2-(benzenesulfonyl)-2-methylpropanoate is sourced from PubChem (CID 135330972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).