C23H23NO5 — CID 10430666
2,2-dimethyl-5-[4-[(E)-(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]phenoxy]pentanoic acid (PubChem CID 10430666) has the molecular formula C23H23NO5 and a molecular weight of 393.44 g/mol. Its IUPAC name is 2,2-dimethyl-5-[4-[(E)-(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]phenoxy]pentanoic acid.
| Compound Name | 2,2-dimethyl-5-[4-[(E)-(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]phenoxy]pentanoic acid |
|---|---|
| PubChem CID | 10430666 |
| Molecular Formula | C23H23NO5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 2,2-dimethyl-5-[4-[(E)-(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]phenoxy]pentanoic acid |
| SMILES | CC(C)(CCCOc1ccc(/C=C2/N=C(c3ccccc3)OC2=O)cc1)C(=O)O |
| InChI | InChI=1S/C23H23NO5/c1-23(2,22(26)27)13-6-14-28-18-11-9-16(10-12-18)15-19-21(25)29-20(24-19)17-7-4-3-5-8-17/h3-5,7-12,15H,6,13-14H2,1-2H3,(H,26,27)/b19-15+ |
| InChIKey | WVZOSKHRGWJDRQ-XDJHFCHBSA-N |
| XLogP | 4.30 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|