C20H39N5O5 — CID 10432795
tert-butyl N-[(3R,5R)-1-[(3-amino-3-iminopropyl)amino]-6-(hexanoylamino)-5-hydroxy-1-oxohexan-3-yl]carbamate (PubChem CID 10432795) has the molecular formula C20H39N5O5 and a molecular weight of 429.56 g/mol. Its IUPAC name is tert-butyl N-[(3R,5R)-1-[(3-amino-3-iminopropyl)amino]-6-(hexanoylamino)-5-hydroxy-1-oxohexan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,5R)-1-[(3-amino-3-iminopropyl)amino]-6-(hexanoylamino)-5-hydroxy-1-oxohexan-3-yl]carbamate |
|---|---|
| PubChem CID | 10432795 |
| Molecular Formula | C20H39N5O5 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.30 |
| IUPAC Name | tert-butyl N-[(3R,5R)-1-[(3-amino-3-iminopropyl)amino]-6-(hexanoylamino)-5-hydroxy-1-oxohexan-3-yl]carbamate |
| SMILES | [H]/N=C(\N)CCNC(=O)C[C@@H](C[C@@H](O)CNC(=O)CCCCC)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H39N5O5/c1-5-6-7-8-17(27)24-13-15(26)11-14(25-19(29)30-20(2,3)4)12-18(28)23-10-9-16(21)22/h14-15,26H,5-13H2,1-4H3,(H3,21,22)(H,23,28)(H,24,27)(H,25,29)/t14-,15-/m1/s1 |
| InChIKey | PBFRTQBMGLIKLS-HUUCEWRRSA-N |
| XLogP | 1.16 |
| TPSA | 166.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|