C15H29Cl2N5O3 — CID 6448060
(3R,5R)-3-amino-N-(3-amino-3-iminopropyl)-6-[[(2E,4Z)-hexa-2,4-dienoyl]amino]-5-hydroxyhexanamide;dihydrochloride (PubChem CID 6448060) has the molecular formula C15H29Cl2N5O3 and a molecular weight of 398.34 g/mol. Its IUPAC name is (3R,5R)-3-amino-N-(3-amino-3-iminopropyl)-6-[[(2E,4Z)-hexa-2,4-dienoyl]amino]-5-hydroxyhexanamide;dihydrochloride.
| Compound Name | (3R,5R)-3-amino-N-(3-amino-3-iminopropyl)-6-[[(2E,4Z)-hexa-2,4-dienoyl]amino]-5-hydroxyhexanamide;dihydrochloride |
|---|---|
| PubChem CID | 6448060 |
| Molecular Formula | C15H29Cl2N5O3 |
| Molecular Weight | 398.34 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | (3R,5R)-3-amino-N-(3-amino-3-iminopropyl)-6-[[(2E,4Z)-hexa-2,4-dienoyl]amino]-5-hydroxyhexanamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)CCNC(=O)C[C@H](N)C[C@@H](O)CNC(=O)/C=C/C=C\C |
| InChI | InChI=1S/C15H27N5O3.2ClH/c1-2-3-4-5-14(22)20-10-12(21)8-11(16)9-15(23)19-7-6-13(17)18;;/h2-5,11-12,21H,6-10,16H2,1H3,(H3,17,18)(H,19,23)(H,20,22);2*1H/b3-2-,5-4+;;/t11-,12-;;/m1../s1 |
| InChIKey | OQKJNDABNFAQAJ-JDZFPWRWSA-N |
| XLogP | -0.01 |
| TPSA | 154.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.34 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|