C24H44N10O6 — CID 10437957
(2E,4E)-N,N'-bis[(2R,4R)-4-amino-6-[(3-amino-3-iminopropyl)amino]-2-hydroxy-6-oxohexyl]hexa-2,4-dienediamide (PubChem CID 10437957) has the molecular formula C24H44N10O6 and a molecular weight of 568.68 g/mol. Its IUPAC name is (2E,4E)-N,N'-bis[(2R,4R)-4-amino-6-[(3-amino-3-iminopropyl)amino]-2-hydroxy-6-oxohexyl]hexa-2,4-dienediamide.
| Compound Name | (2E,4E)-N,N'-bis[(2R,4R)-4-amino-6-[(3-amino-3-iminopropyl)amino]-2-hydroxy-6-oxohexyl]hexa-2,4-dienediamide |
|---|---|
| PubChem CID | 10437957 |
| Molecular Formula | C24H44N10O6 |
| Molecular Weight | 568.68 g/mol |
| Exact Mass | 568.34 |
| IUPAC Name | (2E,4E)-N,N'-bis[(2R,4R)-4-amino-6-[(3-amino-3-iminopropyl)amino]-2-hydroxy-6-oxohexyl]hexa-2,4-dienediamide |
| SMILES | [H]/N=C(\N)CCNC(=O)C[C@H](N)C[C@@H](O)CNC(=O)/C=C/C=C/C(=O)NC[C@H](O)C[C@@H](N)CC(=O)NCC/C(N)=N/[H] |
| InChI | InChI=1S/C24H44N10O6/c25-15(11-23(39)31-7-5-19(27)28)9-17(35)13-33-21(37)3-1-2-4-22(38)34-14-18(36)10-16(26)12-24(40)32-8-6-20(29)30/h1-4,15-18,35-36H,5-14,25-26H2,(H3,27,28)(H3,29,30)(H,31,39)(H,32,40)(H,33,37)(H,34,38)/b3-1+,4-2+/t15-,16-,17-,18-/m1/s1 |
| InChIKey | XWHFEAAIGBZKCE-ROIPYEGRSA-N |
| XLogP | -3.85 |
| TPSA | 308.64 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.68 |
| LogP ≤ 5 | -3.85 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|