C8H12N2O3 — CID 173363491
N'-(2-hydroxyethyl)hexa-2,4-dienediamide (PubChem CID 173363491) has the molecular formula C8H12N2O3 and a molecular weight of 184.20 g/mol. Its IUPAC name is N'-(2-hydroxyethyl)hexa-2,4-dienediamide.
| Compound Name | N'-(2-hydroxyethyl)hexa-2,4-dienediamide |
|---|---|
| PubChem CID | 173363491 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | N'-(2-hydroxyethyl)hexa-2,4-dienediamide |
| SMILES | NC(=O)C=CC=CC(=O)NCCO |
| InChI | InChI=1S/C8H12N2O3/c9-7(12)3-1-2-4-8(13)10-5-6-11/h1-4,11H,5-6H2,(H2,9,12)(H,10,13) |
| InChIKey | DAKPFJVHSXQTIB-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|