C14H25NO2 — CID 53361379
(2E,4E)-N-(2-hydroxyethyl)-6,8-dimethyldeca-2,4-dienamide (PubChem CID 53361379) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is (2E,4E)-N-(2-hydroxyethyl)-6,8-dimethyldeca-2,4-dienamide.
| Compound Name | (2E,4E)-N-(2-hydroxyethyl)-6,8-dimethyldeca-2,4-dienamide |
|---|---|
| PubChem CID | 53361379 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | (2E,4E)-N-(2-hydroxyethyl)-6,8-dimethyldeca-2,4-dienamide |
| SMILES | CCC(C)CC(C)/C=C/C=C/C(=O)NCCO |
| InChI | InChI=1S/C14H25NO2/c1-4-12(2)11-13(3)7-5-6-8-14(17)15-9-10-16/h5-8,12-13,16H,4,9-11H2,1-3H3,(H,15,17)/b7-5+,8-6+ |
| InChIKey | HUHSOGWAMCDHFX-KQQUZDAGSA-N |
| XLogP | 2.28 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|