C20H32N4O8 — CID 10434194
4-[4-[4-[4-(3-carboxypropanoylamino)butyl]-2,5-dioxopiperazin-1-yl]butylamino]-4-oxobutanoic acid (PubChem CID 10434194) has the molecular formula C20H32N4O8 and a molecular weight of 456.50 g/mol. Its IUPAC name is 4-[4-[4-[4-(3-carboxypropanoylamino)butyl]-2,5-dioxopiperazin-1-yl]butylamino]-4-oxobutanoic acid.
| Compound Name | 4-[4-[4-[4-(3-carboxypropanoylamino)butyl]-2,5-dioxopiperazin-1-yl]butylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 10434194 |
| Molecular Formula | C20H32N4O8 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | 4-[4-[4-[4-(3-carboxypropanoylamino)butyl]-2,5-dioxopiperazin-1-yl]butylamino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)NCCCCN1CC(=O)N(CCCCNC(=O)CCC(=O)O)CC1=O |
| InChI | InChI=1S/C20H32N4O8/c25-15(5-7-19(29)30)21-9-1-3-11-23-13-18(28)24(14-17(23)27)12-4-2-10-22-16(26)6-8-20(31)32/h1-14H2,(H,21,25)(H,22,26)(H,29,30)(H,31,32) |
| InChIKey | RFJTWKYEKLRJMQ-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 173.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|