C23H35ClO5S2Si — CID 10436654
ethyl 2-[(2R)-1-acetyloxy-2-[tert-butyl(dimethyl)silyl]oxy-2-(4-chlorophenyl)ethyl]-1,3-dithiane-2-carboxylate (PubChem CID 10436654) has the molecular formula C23H35ClO5S2Si and a molecular weight of 519.20 g/mol. Its IUPAC name is ethyl 2-[(2R)-1-acetyloxy-2-[tert-butyl(dimethyl)silyl]oxy-2-(4-chlorophenyl)ethyl]-1,3-dithiane-2-carboxylate.
| Compound Name | ethyl 2-[(2R)-1-acetyloxy-2-[tert-butyl(dimethyl)silyl]oxy-2-(4-chlorophenyl)ethyl]-1,3-dithiane-2-carboxylate |
|---|---|
| PubChem CID | 10436654 |
| Molecular Formula | C23H35ClO5S2Si |
| Molecular Weight | 519.20 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | ethyl 2-[(2R)-1-acetyloxy-2-[tert-butyl(dimethyl)silyl]oxy-2-(4-chlorophenyl)ethyl]-1,3-dithiane-2-carboxylate |
| SMILES | CCOC(=O)C1(C(OC(C)=O)[C@H](O[Si](C)(C)C(C)(C)C)c2ccc(Cl)cc2)SCCCS1 |
| InChI | InChI=1S/C23H35ClO5S2Si/c1-8-27-21(26)23(30-14-9-15-31-23)20(28-16(2)25)19(17-10-12-18(24)13-11-17)29-32(6,7)22(3,4)5/h10-13,19-20H,8-9,14-15H2,1-7H3/t19-,20?/m1/s1 |
| InChIKey | QUHIIOGJGBRQLN-FIWHBWSRSA-N |
| XLogP | 6.46 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.20 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|