C23H35ClO6Si — CID 10073465
[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-1-(4-chlorophenyl)-4-ethoxy-3,4-dioxobutan-2-yl] 2,2-dimethylpropanoate (PubChem CID 10073465) has the molecular formula C23H35ClO6Si and a molecular weight of 471.07 g/mol. Its IUPAC name is [(1S)-1-[tert-butyl(dimethyl)silyl]oxy-1-(4-chlorophenyl)-4-ethoxy-3,4-dioxobutan-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [(1S)-1-[tert-butyl(dimethyl)silyl]oxy-1-(4-chlorophenyl)-4-ethoxy-3,4-dioxobutan-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10073465 |
| Molecular Formula | C23H35ClO6Si |
| Molecular Weight | 471.07 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | [(1S)-1-[tert-butyl(dimethyl)silyl]oxy-1-(4-chlorophenyl)-4-ethoxy-3,4-dioxobutan-2-yl] 2,2-dimethylpropanoate |
| SMILES | CCOC(=O)C(=O)C(OC(=O)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H35ClO6Si/c1-10-28-20(26)17(25)19(29-21(27)22(2,3)4)18(15-11-13-16(24)14-12-15)30-31(8,9)23(5,6)7/h11-14,18-19H,10H2,1-9H3/t18-,19?/m0/s1 |
| InChIKey | ZSGBKVUCKXLJGB-OYKVQYDMSA-N |
| XLogP | 5.49 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.07 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|