C21H34O4S2Si — CID 10388647
ethyl 2-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-2-phenylethyl]-1,3-dithiane-2-carboxylate (PubChem CID 10388647) has the molecular formula C21H34O4S2Si and a molecular weight of 442.72 g/mol. Its IUPAC name is ethyl 2-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-2-phenylethyl]-1,3-dithiane-2-carboxylate.
| Compound Name | ethyl 2-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-2-phenylethyl]-1,3-dithiane-2-carboxylate |
|---|---|
| PubChem CID | 10388647 |
| Molecular Formula | C21H34O4S2Si |
| Molecular Weight | 442.72 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | ethyl 2-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-2-phenylethyl]-1,3-dithiane-2-carboxylate |
| SMILES | CCOC(=O)C1(C(O)[C@H](O[Si](C)(C)C(C)(C)C)c2ccccc2)SCCCS1 |
| InChI | InChI=1S/C21H34O4S2Si/c1-7-24-19(23)21(26-14-11-15-27-21)18(22)17(16-12-9-8-10-13-16)25-28(5,6)20(2,3)4/h8-10,12-13,17-18,22H,7,11,14-15H2,1-6H3/t17-,18?/m1/s1 |
| InChIKey | DMCOGCYOZTWYBX-QNSVNVJESA-N |
| XLogP | 5.24 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.72 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|