C28H44O5S2Si — CID 11192118
ethyl (5R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-3-oxo-8-[2-[(E)-2-phenylethenyl]-1,3-dithian-2-yl]octanoate (PubChem CID 11192118) has the molecular formula C28H44O5S2Si and a molecular weight of 552.88 g/mol. Its IUPAC name is ethyl (5R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-3-oxo-8-[2-[(E)-2-phenylethenyl]-1,3-dithian-2-yl]octanoate.
| Compound Name | ethyl (5R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-3-oxo-8-[2-[(E)-2-phenylethenyl]-1,3-dithian-2-yl]octanoate |
|---|---|
| PubChem CID | 11192118 |
| Molecular Formula | C28H44O5S2Si |
| Molecular Weight | 552.88 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | ethyl (5R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-3-oxo-8-[2-[(E)-2-phenylethenyl]-1,3-dithian-2-yl]octanoate |
| SMILES | CCOC(=O)CC(=O)C[C@H](O)C[C@@H](CC1(/C=C/c2ccccc2)SCCCS1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H44O5S2Si/c1-7-32-26(31)20-24(30)18-23(29)19-25(33-36(5,6)27(2,3)4)21-28(34-16-11-17-35-28)15-14-22-12-9-8-10-13-22/h8-10,12-15,23,25,29H,7,11,16-21H2,1-6H3/b15-14+/t23-,25-/m0/s1 |
| InChIKey | FYIPYSPXYIELDU-QZMWHONUSA-N |
| XLogP | 6.71 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.88 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|