C18H26O4S — CID 10569036
ethyl (4S,5R)-4-ethylsulfanylcarbonyl-5-hydroxy-7-phenylheptanoate (PubChem CID 10569036) has the molecular formula C18H26O4S and a molecular weight of 338.47 g/mol. Its IUPAC name is ethyl (4S,5R)-4-ethylsulfanylcarbonyl-5-hydroxy-7-phenylheptanoate.
| Compound Name | ethyl (4S,5R)-4-ethylsulfanylcarbonyl-5-hydroxy-7-phenylheptanoate |
|---|---|
| PubChem CID | 10569036 |
| Molecular Formula | C18H26O4S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | ethyl (4S,5R)-4-ethylsulfanylcarbonyl-5-hydroxy-7-phenylheptanoate |
| SMILES | CCOC(=O)CC[C@H](C(=O)SCC)[C@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C18H26O4S/c1-3-22-17(20)13-11-15(18(21)23-4-2)16(19)12-10-14-8-6-5-7-9-14/h5-9,15-16,19H,3-4,10-13H2,1-2H3/t15-,16+/m0/s1 |
| InChIKey | ZCUMWUKHXZMDCZ-JKSUJKDBSA-N |
| XLogP | 3.22 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|