C24H40O5SSi — CID 135032365
[(3S,5S,6R)-6-ethylsulfanyl-4-hydroxy-2-methyl-5-tri(propan-2-yl)silyloxyoxan-3-yl] benzoate (PubChem CID 135032365) has the molecular formula C24H40O5SSi and a molecular weight of 468.73 g/mol. Its IUPAC name is [(3S,5S,6R)-6-ethylsulfanyl-4-hydroxy-2-methyl-5-tri(propan-2-yl)silyloxyoxan-3-yl] benzoate.
| Compound Name | [(3S,5S,6R)-6-ethylsulfanyl-4-hydroxy-2-methyl-5-tri(propan-2-yl)silyloxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 135032365 |
| Molecular Formula | C24H40O5SSi |
| Molecular Weight | 468.73 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | [(3S,5S,6R)-6-ethylsulfanyl-4-hydroxy-2-methyl-5-tri(propan-2-yl)silyloxyoxan-3-yl] benzoate |
| SMILES | CCS[C@H]1OC(C)[C@@H](OC(=O)c2ccccc2)C(O)[C@@H]1O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C24H40O5SSi/c1-9-30-24-22(29-31(15(2)3,16(4)5)17(6)7)20(25)21(18(8)27-24)28-23(26)19-13-11-10-12-14-19/h10-18,20-22,24-25H,9H2,1-8H3/t18?,20?,21-,22+,24-/m1/s1 |
| InChIKey | VZGFZZCDGMLRES-FCBWNXKGSA-N |
| XLogP | 5.63 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.73 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|