C21H26F3NO5S2Si2 — CID 10437533
[2-trimethylsilyl-1-(2-trimethylsilylphenyl)sulfonylindol-3-yl] trifluoromethanesulfonate (PubChem CID 10437533) has the molecular formula C21H26F3NO5S2Si2 and a molecular weight of 549.74 g/mol. Its IUPAC name is [2-trimethylsilyl-1-(2-trimethylsilylphenyl)sulfonylindol-3-yl] trifluoromethanesulfonate.
| Compound Name | [2-trimethylsilyl-1-(2-trimethylsilylphenyl)sulfonylindol-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10437533 |
| Molecular Formula | C21H26F3NO5S2Si2 |
| Molecular Weight | 549.74 g/mol |
| Exact Mass | 549.07 |
| IUPAC Name | [2-trimethylsilyl-1-(2-trimethylsilylphenyl)sulfonylindol-3-yl] trifluoromethanesulfonate |
| SMILES | C[Si](C)(C)c1ccccc1S(=O)(=O)n1c([Si](C)(C)C)c(OS(=O)(=O)C(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C21H26F3NO5S2Si2/c1-33(2,3)18-14-10-9-13-17(18)31(26,27)25-16-12-8-7-11-15(16)19(20(25)34(4,5)6)30-32(28,29)21(22,23)24/h7-14H,1-6H3 |
| InChIKey | FYPRULGRPOSSAK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 82.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.74 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|