C25H30INO5 — CID 10437574
(1-methylquinolin-1-ium-6-yl) 4-hexoxy-3,5-dimethoxybenzoate iodide (PubChem CID 10437574) has the molecular formula C25H30INO5 and a molecular weight of 551.42 g/mol. Its IUPAC name is (1-methylquinolin-1-ium-6-yl) 4-hexoxy-3,5-dimethoxybenzoate iodide.
| Compound Name | (1-methylquinolin-1-ium-6-yl) 4-hexoxy-3,5-dimethoxybenzoate iodide |
|---|---|
| PubChem CID | 10437574 |
| Molecular Formula | C25H30INO5 |
| Molecular Weight | 551.42 g/mol |
| Exact Mass | 551.12 |
| IUPAC Name | (1-methylquinolin-1-ium-6-yl) 4-hexoxy-3,5-dimethoxybenzoate iodide |
| SMILES | CCCCCCOc1c(OC)cc(C(=O)Oc2ccc3c(ccc[n+]3C)c2)cc1OC.[I-] |
| InChI | InChI=1S/C25H30NO5.HI/c1-5-6-7-8-14-30-24-22(28-3)16-19(17-23(24)29-4)25(27)31-20-11-12-21-18(15-20)10-9-13-26(21)2;/h9-13,15-17H,5-8,14H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | ATJKSQLROOSVPY-UHFFFAOYSA-M |
| XLogP | 1.86 |
| TPSA | 57.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.42 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|