C26H38INO5 — CID 10415639
2-[4-(4-hexoxy-3,5-dimethoxybenzoyl)oxyphenyl]ethyl-trimethylazanium iodide (PubChem CID 10415639) has the molecular formula C26H38INO5 and a molecular weight of 571.50 g/mol. Its IUPAC name is 2-[4-(4-hexoxy-3,5-dimethoxybenzoyl)oxyphenyl]ethyl-trimethylazanium iodide.
| Compound Name | 2-[4-(4-hexoxy-3,5-dimethoxybenzoyl)oxyphenyl]ethyl-trimethylazanium iodide |
|---|---|
| PubChem CID | 10415639 |
| Molecular Formula | C26H38INO5 |
| Molecular Weight | 571.50 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | 2-[4-(4-hexoxy-3,5-dimethoxybenzoyl)oxyphenyl]ethyl-trimethylazanium iodide |
| SMILES | CCCCCCOc1c(OC)cc(C(=O)Oc2ccc(CC[N+](C)(C)C)cc2)cc1OC.[I-] |
| InChI | InChI=1S/C26H38NO5.HI/c1-7-8-9-10-17-31-25-23(29-5)18-21(19-24(25)30-6)26(28)32-22-13-11-20(12-14-22)15-16-27(2,3)4;/h11-14,18-19H,7-10,15-17H2,1-6H3;1H/q+1;/p-1 |
| InChIKey | MSRGJABDFXKIHO-UHFFFAOYSA-M |
| XLogP | 2.13 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.50 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|