C37H46F2N2O3 — CID 10438617
1-[4-(3,5-ditert-butyl-4-hydroxybenzoyl)piperazin-1-yl]-6,6-bis(4-fluorophenyl)hexan-1-one (PubChem CID 10438617) has the molecular formula C37H46F2N2O3 and a molecular weight of 604.78 g/mol. Its IUPAC name is 1-[4-(3,5-ditert-butyl-4-hydroxybenzoyl)piperazin-1-yl]-6,6-bis(4-fluorophenyl)hexan-1-one.
| Compound Name | 1-[4-(3,5-ditert-butyl-4-hydroxybenzoyl)piperazin-1-yl]-6,6-bis(4-fluorophenyl)hexan-1-one |
|---|---|
| PubChem CID | 10438617 |
| Molecular Formula | C37H46F2N2O3 |
| Molecular Weight | 604.78 g/mol |
| Exact Mass | 604.35 |
| IUPAC Name | 1-[4-(3,5-ditert-butyl-4-hydroxybenzoyl)piperazin-1-yl]-6,6-bis(4-fluorophenyl)hexan-1-one |
| SMILES | CC(C)(C)c1cc(C(=O)N2CCN(C(=O)CCCCC(c3ccc(F)cc3)c3ccc(F)cc3)CC2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C37H46F2N2O3/c1-36(2,3)31-23-27(24-32(34(31)43)37(4,5)6)35(44)41-21-19-40(20-22-41)33(42)10-8-7-9-30(25-11-15-28(38)16-12-25)26-13-17-29(39)18-14-26/h11-18,23-24,30,43H,7-10,19-22H2,1-6H3 |
| InChIKey | JLPSMXPDEKOWNN-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.78 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|