C10H14 — CID 10441753
(1Z)-tricyclo[7.1.0.04,6]dec-1-ene (PubChem CID 10441753) has the molecular formula C10H14 and a molecular weight of 134.22 g/mol. Its IUPAC name is (1Z)-tricyclo[7.1.0.04,6]dec-1-ene.
| Compound Name | (1Z)-tricyclo[7.1.0.04,6]dec-1-ene |
|---|---|
| PubChem CID | 10441753 |
| Molecular Formula | C10H14 |
| Molecular Weight | 134.22 g/mol |
| Exact Mass | 134.11 |
| IUPAC Name | (1Z)-tricyclo[7.1.0.04,6]dec-1-ene |
| SMILES | C1=C2/CC2CCC2CC2C/1 |
| InChI | InChI=1S/C10H14/c1-2-8-6-10(8)4-3-9-5-7(1)9/h1,8-10H,2-6H2/b7-1- |
| InChIKey | ICEOUKRORHJFOQ-XFSBKJJWSA-N |
| XLogP | 2.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.22 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|