C11H14 — CID 163995115
(2R)-4-methyltricyclo[5.2.1.02,6]deca-1(9),5-diene (PubChem CID 163995115) has the molecular formula C11H14 and a molecular weight of 146.23 g/mol. Its IUPAC name is (2R)-4-methyltricyclo[5.2.1.02,6]deca-1(9),5-diene.
| Compound Name | (2R)-4-methyltricyclo[5.2.1.02,6]deca-1(9),5-diene |
|---|---|
| PubChem CID | 163995115 |
| Molecular Formula | C11H14 |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | (2R)-4-methyltricyclo[5.2.1.02,6]deca-1(9),5-diene |
| SMILES | CC1C=C2C3CC=C(C3)[C@H]2C1 |
| InChI | InChI=1S/C11H14/c1-7-4-10-8-2-3-9(6-8)11(10)5-7/h2,5,7,9-10H,3-4,6H2,1H3/t7?,9?,10-/m1/s1 |
| InChIKey | UEAFTSGUMDLKMN-YXGXMSFMSA-N |
| XLogP | 2.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|