C15H19ClO — CID 162411346
(2R,10S,12S)-12-chlorotricyclo[8.4.1.02,7]pentadeca-1(14),7-dien-9-one (PubChem CID 162411346) has the molecular formula C15H19ClO and a molecular weight of 250.77 g/mol. Its IUPAC name is (2R,10S,12S)-12-chlorotricyclo[8.4.1.02,7]pentadeca-1(14),7-dien-9-one.
| Compound Name | (2R,10S,12S)-12-chlorotricyclo[8.4.1.02,7]pentadeca-1(14),7-dien-9-one |
|---|---|
| PubChem CID | 162411346 |
| Molecular Formula | C15H19ClO |
| Molecular Weight | 250.77 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | (2R,10S,12S)-12-chlorotricyclo[8.4.1.02,7]pentadeca-1(14),7-dien-9-one |
| SMILES | O=C1C=C2CCCC[C@@H]2C2=CC[C@H](Cl)C[C@@H]1C2 |
| InChI | InChI=1S/C15H19ClO/c16-13-6-5-11-7-12(8-13)15(17)9-10-3-1-2-4-14(10)11/h5,9,12-14H,1-4,6-8H2/t12-,13-,14-/m0/s1 |
| InChIKey | WKKWOMOHQSRSRA-IHRRRGAJSA-N |
| XLogP | 4.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.77 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|