C10H14O2 — CID 23008857
2,3,3a,4,5,6-hexahydro-1H-indene-5-carboxylic acid (PubChem CID 23008857) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is 2,3,3a,4,5,6-hexahydro-1H-indene-5-carboxylic acid.
| Compound Name | 2,3,3a,4,5,6-hexahydro-1H-indene-5-carboxylic acid |
|---|---|
| PubChem CID | 23008857 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 2,3,3a,4,5,6-hexahydro-1H-indene-5-carboxylic acid |
| SMILES | O=C(O)C1CC=C2CCCC2C1 |
| InChI | InChI=1S/C10H14O2/c11-10(12)9-5-4-7-2-1-3-8(7)6-9/h4,8-9H,1-3,5-6H2,(H,11,12) |
| InChIKey | OQTLKUQQWRCASD-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|