C10H15NO3 — CID 98469818
(1S,5S)-9-hydroxyiminobicyclo[3.3.1]nonane-3-carboxylic acid (PubChem CID 98469818) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is (1S,5S)-9-hydroxyiminobicyclo[3.3.1]nonane-3-carboxylic acid.
| Compound Name | (1S,5S)-9-hydroxyiminobicyclo[3.3.1]nonane-3-carboxylic acid |
|---|---|
| PubChem CID | 98469818 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | (1S,5S)-9-hydroxyiminobicyclo[3.3.1]nonane-3-carboxylic acid |
| SMILES | O=C(O)C1C[C@@H]2CCC[C@@H](C1)C2=NO |
| InChI | InChI=1S/C10H15NO3/c12-10(13)8-4-6-2-1-3-7(5-8)9(6)11-14/h6-8,14H,1-5H2,(H,12,13)/b11-9-/t6-,7-,8?/m0/s1 |
| InChIKey | QDCBCYFDEISDDF-PVPIZIINSA-N |
| XLogP | 1.73 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|